About (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one
(3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one (PubChem CID 82415154) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one.
Molecular Properties
| Compound Name | (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one |
| PubChem CID | 82415154 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one |
| SMILES | C[C@@H]1Nc2cnccc2NC1=O |
| InChI | InChI=1S/C8H9N3O/c1-5-8(12)11-6-2-3-9-4-7(6)10-5/h2-5,10H,1H3,(H,11,12)/t5-/m0/s1 |
| InChIKey | AZCCYNDIEOBLIV-YFKPBYRVSA-N |
| XLogP | 0.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one?
The IUPAC name of (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one (CID 82415154) is (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one.
What is the SMILES notation for (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one?
The canonical SMILES for (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one is C[C@@H]1Nc2cnccc2NC1=O.
What is the InChIKey of (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one?
The InChIKey is AZCCYNDIEOBLIV-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5-8(12)11-6-2-3-9-4-7(6)10-5/h2-5,10H,1H3,(H,11,12)/t5-/m0/s1.
What are the key properties of (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one?
(3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one has a molecular weight of 163.18 g/mol, XLogP of 0.83, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methyl-3,4-dihydro-1H-pyrido[3,4-b]pyrazin-2-one is sourced from PubChem (CID 82415154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).