About pyrido[4,3-d]pyrimidin-5-ylmethanamine
pyrido[4,3-d]pyrimidin-5-ylmethanamine (PubChem CID 82415563) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is pyrido[4,3-d]pyrimidin-5-ylmethanamine.
Molecular Properties
| Compound Name | pyrido[4,3-d]pyrimidin-5-ylmethanamine |
| PubChem CID | 82415563 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | pyrido[4,3-d]pyrimidin-5-ylmethanamine |
| SMILES | NCc1nccc2ncncc12 |
| InChI | InChI=1S/C8H8N4/c9-3-8-6-4-10-5-12-7(6)1-2-11-8/h1-2,4-5H,3,9H2 |
| InChIKey | CSWIEUUVGDRAFM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrido[4,3-d]pyrimidin-5-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[4,3-d]pyrimidin-5-ylmethanamine?
The IUPAC name of pyrido[4,3-d]pyrimidin-5-ylmethanamine (CID 82415563) is pyrido[4,3-d]pyrimidin-5-ylmethanamine.
What is the SMILES notation for pyrido[4,3-d]pyrimidin-5-ylmethanamine?
The canonical SMILES for pyrido[4,3-d]pyrimidin-5-ylmethanamine is NCc1nccc2ncncc12.
What is the InChIKey of pyrido[4,3-d]pyrimidin-5-ylmethanamine?
The InChIKey is CSWIEUUVGDRAFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c9-3-8-6-4-10-5-12-7(6)1-2-11-8/h1-2,4-5H,3,9H2.
What are the key properties of pyrido[4,3-d]pyrimidin-5-ylmethanamine?
pyrido[4,3-d]pyrimidin-5-ylmethanamine has a molecular weight of 160.18 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[4,3-d]pyrimidin-5-ylmethanamine is sourced from PubChem (CID 82415563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).