C9H8N2O — CID 82415580
1-methylpyrrolo[3,2-c]pyridine-2-carbaldehyde (PubChem CID 82415580) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 1-methylpyrrolo[3,2-c]pyridine-2-carbaldehyde.
| Compound Name | 1-methylpyrrolo[3,2-c]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 82415580 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1-methylpyrrolo[3,2-c]pyridine-2-carbaldehyde |
| SMILES | Cn1c(C=O)cc2cnccc21 |
| InChI | InChI=1S/C9H8N2O/c1-11-8(6-12)4-7-5-10-3-2-9(7)11/h2-6H,1H3 |
| InChIKey | OHGSLAAXLOGMLK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|