About 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid
2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid (PubChem CID 82415692) has the molecular formula C5H5NO3S
and a molecular weight of 159.17 g/mol. Its IUPAC name is 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid |
| PubChem CID | 82415692 |
| Molecular Formula | C5H5NO3S |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.00 |
| IUPAC Name | 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid |
| SMILES | O=C(O)C(O)c1ccns1 |
| InChI | InChI=1S/C5H5NO3S/c7-4(5(8)9)3-1-2-6-10-3/h1-2,4,7H,(H,8,9) |
| InChIKey | NTQHABWQNWEMCK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid?
The IUPAC name of 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid (CID 82415692) is 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid is O=C(O)C(O)c1ccns1.
What is the InChIKey of 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid?
The InChIKey is NTQHABWQNWEMCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3S/c7-4(5(8)9)3-1-2-6-10-3/h1-2,4,7H,(H,8,9).
What are the key properties of 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid?
2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid has a molecular weight of 159.17 g/mol, XLogP of 0.26, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(1,2-thiazol-5-yl)acetic acid is sourced from PubChem (CID 82415692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).