About 2-(3-aminopropyl)-1,3-thiazol-5-amine
2-(3-aminopropyl)-1,3-thiazol-5-amine (PubChem CID 82415863) has the molecular formula C6H11N3S
and a molecular weight of 157.24 g/mol. Its IUPAC name is 2-(3-aminopropyl)-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-(3-aminopropyl)-1,3-thiazol-5-amine |
| PubChem CID | 82415863 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 2-(3-aminopropyl)-1,3-thiazol-5-amine |
| SMILES | NCCCc1ncc(N)s1 |
| InChI | InChI=1S/C6H11N3S/c7-3-1-2-6-9-4-5(8)10-6/h4H,1-3,7-8H2 |
| InChIKey | JWBDJNAPIDJECT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-aminopropyl)-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopropyl)-1,3-thiazol-5-amine?
The IUPAC name of 2-(3-aminopropyl)-1,3-thiazol-5-amine (CID 82415863) is 2-(3-aminopropyl)-1,3-thiazol-5-amine.
What is the SMILES notation for 2-(3-aminopropyl)-1,3-thiazol-5-amine?
The canonical SMILES for 2-(3-aminopropyl)-1,3-thiazol-5-amine is NCCCc1ncc(N)s1.
What is the InChIKey of 2-(3-aminopropyl)-1,3-thiazol-5-amine?
The InChIKey is JWBDJNAPIDJECT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3S/c7-3-1-2-6-9-4-5(8)10-6/h4H,1-3,7-8H2.
What are the key properties of 2-(3-aminopropyl)-1,3-thiazol-5-amine?
2-(3-aminopropyl)-1,3-thiazol-5-amine has a molecular weight of 157.24 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopropyl)-1,3-thiazol-5-amine is sourced from PubChem (CID 82415863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).