5-formyl-1,3-thiazole-2-carboxylic acid

C5H3NO3S — CID 82415952

IUPAC5-formyl-1,3-thiazole-2-carboxylic acid
SMILESO=Cc1cnc(C(=O)O)s1
InChIInChI=1S/C5H3NO3S/c7-2-3-1-6-4(10-3)5(8)9/h1-2H,(H,8,9)
InChIKeyOHZRLTQRHSTAKC-UHFFFAOYSA-N
MW157.15 g/mol
LogP0.65
Rot. Bonds2

About 5-formyl-1,3-thiazole-2-carboxylic acid

5-formyl-1,3-thiazole-2-carboxylic acid (PubChem CID 82415952) has the molecular formula C5H3NO3S and a molecular weight of 157.15 g/mol. Its IUPAC name is 5-formyl-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name5-formyl-1,3-thiazole-2-carboxylic acid
PubChem CID82415952
Molecular FormulaC5H3NO3S
Molecular Weight157.15 g/mol
Exact Mass156.98
IUPAC Name5-formyl-1,3-thiazole-2-carboxylic acid
SMILESO=Cc1cnc(C(=O)O)s1
InChIInChI=1S/C5H3NO3S/c7-2-3-1-6-4(10-3)5(8)9/h1-2H,(H,8,9)
InChIKeyOHZRLTQRHSTAKC-UHFFFAOYSA-N
XLogP0.65
TPSA67.26 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.15
LogP ≤ 50.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 5-formyl-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-formyl-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 5-formyl-1,3-thiazole-2-carboxylic acid (CID 82415952) is 5-formyl-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 5-formyl-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 5-formyl-1,3-thiazole-2-carboxylic acid is O=Cc1cnc(C(=O)O)s1.
What is the InChIKey of 5-formyl-1,3-thiazole-2-carboxylic acid?
The InChIKey is OHZRLTQRHSTAKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3NO3S/c7-2-3-1-6-4(10-3)5(8)9/h1-2H,(H,8,9).
What are the key properties of 5-formyl-1,3-thiazole-2-carboxylic acid?
5-formyl-1,3-thiazole-2-carboxylic acid has a molecular weight of 157.15 g/mol, XLogP of 0.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-formyl-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 82415952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).