C9H20N2 — CID 82416011
[(2R,3R)-2-ethyl-1-methylpiperidin-3-yl]methanamine (PubChem CID 82416011) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is [(2R,3R)-2-ethyl-1-methylpiperidin-3-yl]methanamine.
| Compound Name | [(2R,3R)-2-ethyl-1-methylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 82416011 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | [(2R,3R)-2-ethyl-1-methylpiperidin-3-yl]methanamine |
| SMILES | CC[C@@H]1[C@@H](CN)CCCN1C |
| InChI | InChI=1S/C9H20N2/c1-3-9-8(7-10)5-4-6-11(9)2/h8-9H,3-7,10H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | AUQVPBNTDCQNEV-RKDXNWHRSA-N |
| XLogP | 1.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |