C7H12N2S — CID 82416048
(5-propan-2-yl-1,2-thiazol-4-yl)methanamine (PubChem CID 82416048) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is (5-propan-2-yl-1,2-thiazol-4-yl)methanamine.
| Compound Name | (5-propan-2-yl-1,2-thiazol-4-yl)methanamine |
|---|---|
| PubChem CID | 82416048 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (5-propan-2-yl-1,2-thiazol-4-yl)methanamine |
| SMILES | CC(C)c1sncc1CN |
| InChI | InChI=1S/C7H12N2S/c1-5(2)7-6(3-8)4-9-10-7/h4-5H,3,8H2,1-2H3 |
| InChIKey | SIPAFIONUVZOGB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |