About 5-methylsulfanyl-1,2-thiazole-4-carbonitrile
5-methylsulfanyl-1,2-thiazole-4-carbonitrile (PubChem CID 82416073) has the molecular formula C5H4N2S2
and a molecular weight of 156.24 g/mol. Its IUPAC name is 5-methylsulfanyl-1,2-thiazole-4-carbonitrile.
Analyze 5-methylsulfanyl-1,2-thiazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfanyl-1,2-thiazole-4-carbonitrile?
The IUPAC name of 5-methylsulfanyl-1,2-thiazole-4-carbonitrile (CID 82416073) is 5-methylsulfanyl-1,2-thiazole-4-carbonitrile.
What is the SMILES notation for 5-methylsulfanyl-1,2-thiazole-4-carbonitrile?
The canonical SMILES for 5-methylsulfanyl-1,2-thiazole-4-carbonitrile is CSc1sncc1C#N.
What is the InChIKey of 5-methylsulfanyl-1,2-thiazole-4-carbonitrile?
The InChIKey is JIYBAJRTBYMHBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2S2/c1-8-5-4(2-6)3-7-9-5/h3H,1H3.
What are the key properties of 5-methylsulfanyl-1,2-thiazole-4-carbonitrile?
5-methylsulfanyl-1,2-thiazole-4-carbonitrile has a molecular weight of 156.24 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanyl-1,2-thiazole-4-carbonitrile is sourced from PubChem (CID 82416073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).