About 5-methylsulfanyl-1,2-thiazole-4-carbonitrile
5-methylsulfanyl-1,2-thiazole-4-carbonitrile (PubChem CID 82416073) has the molecular formula C5H4N2S2
and a molecular weight of 156.24 g/mol. Its IUPAC name is 5-methylsulfanyl-1,2-thiazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-methylsulfanyl-1,2-thiazole-4-carbonitrile |
| PubChem CID | 82416073 |
| Molecular Formula | C5H4N2S2 |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 155.98 |
| IUPAC Name | 5-methylsulfanyl-1,2-thiazole-4-carbonitrile |
| SMILES | CSc1sncc1C#N |
| InChI | InChI=1S/C5H4N2S2/c1-8-5-4(2-6)3-7-9-5/h3H,1H3 |
| InChIKey | JIYBAJRTBYMHBJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylsulfanyl-1,2-thiazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfanyl-1,2-thiazole-4-carbonitrile?
The IUPAC name of 5-methylsulfanyl-1,2-thiazole-4-carbonitrile (CID 82416073) is 5-methylsulfanyl-1,2-thiazole-4-carbonitrile.
What is the SMILES notation for 5-methylsulfanyl-1,2-thiazole-4-carbonitrile?
The canonical SMILES for 5-methylsulfanyl-1,2-thiazole-4-carbonitrile is CSc1sncc1C#N.
What is the InChIKey of 5-methylsulfanyl-1,2-thiazole-4-carbonitrile?
The InChIKey is JIYBAJRTBYMHBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2S2/c1-8-5-4(2-6)3-7-9-5/h3H,1H3.
What are the key properties of 5-methylsulfanyl-1,2-thiazole-4-carbonitrile?
5-methylsulfanyl-1,2-thiazole-4-carbonitrile has a molecular weight of 156.24 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanyl-1,2-thiazole-4-carbonitrile is sourced from PubChem (CID 82416073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).