About 8-oxa-1,4-diazaspiro[5.5]undecane
8-oxa-1,4-diazaspiro[5.5]undecane (PubChem CID 82416083) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 8-oxa-1,4-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 8-oxa-1,4-diazaspiro[5.5]undecane |
| PubChem CID | 82416083 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 8-oxa-1,4-diazaspiro[5.5]undecane |
| SMILES | C1COCC2(C1)CNCCN2 |
| InChI | InChI=1S/C8H16N2O/c1-2-8(7-11-5-1)6-9-3-4-10-8/h9-10H,1-7H2 |
| InChIKey | ARTBMSOSSQTHKF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-oxa-1,4-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxa-1,4-diazaspiro[5.5]undecane?
The IUPAC name of 8-oxa-1,4-diazaspiro[5.5]undecane (CID 82416083) is 8-oxa-1,4-diazaspiro[5.5]undecane.
What is the SMILES notation for 8-oxa-1,4-diazaspiro[5.5]undecane?
The canonical SMILES for 8-oxa-1,4-diazaspiro[5.5]undecane is C1COCC2(C1)CNCCN2.
What is the InChIKey of 8-oxa-1,4-diazaspiro[5.5]undecane?
The InChIKey is ARTBMSOSSQTHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-2-8(7-11-5-1)6-9-3-4-10-8/h9-10H,1-7H2.
What are the key properties of 8-oxa-1,4-diazaspiro[5.5]undecane?
8-oxa-1,4-diazaspiro[5.5]undecane has a molecular weight of 156.23 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxa-1,4-diazaspiro[5.5]undecane is sourced from PubChem (CID 82416083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).