About 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol
1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol (PubChem CID 82416156) has the molecular formula C7H12N2O2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol |
| PubChem CID | 82416156 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol |
| SMILES | Cc1cnc(CC(O)CN)o1 |
| InChI | InChI=1S/C7H12N2O2/c1-5-4-9-7(11-5)2-6(10)3-8/h4,6,10H,2-3,8H2,1H3 |
| InChIKey | FFYKRPFPLPFBPU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol?
The IUPAC name of 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol (CID 82416156) is 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol.
What is the SMILES notation for 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol?
The canonical SMILES for 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol is Cc1cnc(CC(O)CN)o1.
What is the InChIKey of 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol?
The InChIKey is FFYKRPFPLPFBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-5-4-9-7(11-5)2-6(10)3-8/h4,6,10H,2-3,8H2,1H3.
What are the key properties of 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol?
1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol has a molecular weight of 156.19 g/mol, XLogP of -0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(5-methyl-1,3-oxazol-2-yl)propan-2-ol is sourced from PubChem (CID 82416156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).