C7H12N2O2 — CID 82416167
2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine (PubChem CID 82416167) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine.
| Compound Name | 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 82416167 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine |
| SMILES | COCC(N)c1ncc(C)o1 |
| InChI | InChI=1S/C7H12N2O2/c1-5-3-9-7(11-5)6(8)4-10-2/h3,6H,4,8H2,1-2H3 |
| InChIKey | NGRQTCUQNGHITG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |