About 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine
2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine (PubChem CID 82416167) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine |
| PubChem CID | 82416167 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine |
| SMILES | COCC(N)c1ncc(C)o1 |
| InChI | InChI=1S/C7H12N2O2/c1-5-3-9-7(11-5)6(8)4-10-2/h3,6H,4,8H2,1-2H3 |
| InChIKey | NGRQTCUQNGHITG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine?
The IUPAC name of 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine (CID 82416167) is 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine.
What is the SMILES notation for 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine?
The canonical SMILES for 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine is COCC(N)c1ncc(C)o1.
What is the InChIKey of 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine?
The InChIKey is NGRQTCUQNGHITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-5-3-9-7(11-5)6(8)4-10-2/h3,6H,4,8H2,1-2H3.
What are the key properties of 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine?
2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine has a molecular weight of 156.18 g/mol, XLogP of 0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-(5-methyl-1,3-oxazol-2-yl)ethanamine is sourced from PubChem (CID 82416167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).