2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid

C6H8N2O3 — CID 82416208

IUPAC2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid
SMILESCc1coc(C(N)C(=O)O)n1
InChIInChI=1S/C6H8N2O3/c1-3-2-11-5(8-3)4(7)6(9)10/h2,4H,7H2,1H3,(H,9,10)
InChIKeyWBDLVGQHYZYJBH-UHFFFAOYSA-N
MW156.14 g/mol
LogP0.07
Rot. Bonds2

About 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid

2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid (PubChem CID 82416208) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid
PubChem CID82416208
Molecular FormulaC6H8N2O3
Molecular Weight156.14 g/mol
Exact Mass156.05
IUPAC Name2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid
SMILESCc1coc(C(N)C(=O)O)n1
InChIInChI=1S/C6H8N2O3/c1-3-2-11-5(8-3)4(7)6(9)10/h2,4H,7H2,1H3,(H,9,10)
InChIKeyWBDLVGQHYZYJBH-UHFFFAOYSA-N
XLogP0.07
TPSA89.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.14
LogP ≤ 50.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid?
The IUPAC name of 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid (CID 82416208) is 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid.
What is the SMILES notation for 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid?
The canonical SMILES for 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid is Cc1coc(C(N)C(=O)O)n1.
What is the InChIKey of 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid?
The InChIKey is WBDLVGQHYZYJBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-3-2-11-5(8-3)4(7)6(9)10/h2,4H,7H2,1H3,(H,9,10).
What are the key properties of 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid?
2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid has a molecular weight of 156.14 g/mol, XLogP of 0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(4-methyl-1,3-oxazol-2-yl)acetic acid is sourced from PubChem (CID 82416208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).