About 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine
1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine (PubChem CID 82416295) has the molecular formula C6H9N3S
and a molecular weight of 155.23 g/mol. Its IUPAC name is 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine.
Analyze 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine?
The IUPAC name of 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine (CID 82416295) is 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine.
What is the SMILES notation for 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine?
The canonical SMILES for 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine is Nc1n[nH]c2c1CSCC2.
What is the InChIKey of 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine?
The InChIKey is JXKGQVXJEOALGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S/c7-6-4-3-10-2-1-5(4)8-9-6/h1-3H2,(H3,7,8,9).
What are the key properties of 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine?
1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine has a molecular weight of 155.23 g/mol, XLogP of 0.78, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-amine is sourced from PubChem (CID 82416295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).