About N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide
N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide (PubChem CID 824163) has the molecular formula C19H20N4O
and a molecular weight of 320.40 g/mol. Its IUPAC name is N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide.
Molecular Properties
| Compound Name | N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide |
| PubChem CID | 824163 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide |
| SMILES | O=C(NNC1=NC2(CCCC2)Cc2ccccc21)c1cccnc1 |
| InChI | InChI=1S/C19H20N4O/c24-18(15-7-5-11-20-13-15)23-22-17-16-8-2-1-6-14(16)12-19(21-17)9-3-4-10-19/h1-2,5-8,11,13H,3-4,9-10,12H2,(H,21,22)(H,23,24) |
| InChIKey | UDEOTVWGZBMHRP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide?
The IUPAC name of N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide (CID 824163) is N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide.
What is the SMILES notation for N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide?
The canonical SMILES for N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide is O=C(NNC1=NC2(CCCC2)Cc2ccccc21)c1cccnc1.
What is the InChIKey of N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide?
The InChIKey is UDEOTVWGZBMHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O/c24-18(15-7-5-11-20-13-15)23-22-17-16-8-2-1-6-14(16)12-19(21-17)9-3-4-10-19/h1-2,5-8,11,13H,3-4,9-10,12H2,(H,21,22)(H,23,24).
What are the key properties of N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide?
N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide has a molecular weight of 320.40 g/mol, XLogP of 2.63, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylpyridine-3-carbohydrazide is sourced from PubChem (CID 824163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).