About 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile
5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile (PubChem CID 82416625) has the molecular formula C5H6N4S
and a molecular weight of 154.20 g/mol. Its IUPAC name is 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile |
| PubChem CID | 82416625 |
| Molecular Formula | C5H6N4S |
| Molecular Weight | 154.20 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile |
| SMILES | CN(C)c1nc(C#N)ns1 |
| InChI | InChI=1S/C5H6N4S/c1-9(2)5-7-4(3-6)8-10-5/h1-2H3 |
| InChIKey | UXYRADCHYZLVGF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile?
The IUPAC name of 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile (CID 82416625) is 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile.
What is the SMILES notation for 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile?
The canonical SMILES for 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile is CN(C)c1nc(C#N)ns1.
What is the InChIKey of 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile?
The InChIKey is UXYRADCHYZLVGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4S/c1-9(2)5-7-4(3-6)8-10-5/h1-2H3.
What are the key properties of 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile?
5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile has a molecular weight of 154.20 g/mol, XLogP of 0.48, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-1,2,4-thiadiazole-3-carbonitrile is sourced from PubChem (CID 82416625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).