2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid

C7H10N2O2 — CID 82416662

IUPAC2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid
SMILESCc1[nH]nc(CC(=O)O)c1C
InChIInChI=1S/C7H10N2O2/c1-4-5(2)8-9-6(4)3-7(10)11/h3H2,1-2H3,(H,8,9)(H,10,11)
InChIKeyLDOLRTRTEIZUSH-UHFFFAOYSA-N
MW154.17 g/mol
LogP0.65
Rot. Bonds2

About 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid

2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid (PubChem CID 82416662) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid
PubChem CID82416662
Molecular FormulaC7H10N2O2
Molecular Weight154.17 g/mol
Exact Mass154.07
IUPAC Name2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid
SMILESCc1[nH]nc(CC(=O)O)c1C
InChIInChI=1S/C7H10N2O2/c1-4-5(2)8-9-6(4)3-7(10)11/h3H2,1-2H3,(H,8,9)(H,10,11)
InChIKeyLDOLRTRTEIZUSH-UHFFFAOYSA-N
XLogP0.65
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.17
LogP ≤ 50.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid?
The IUPAC name of 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid (CID 82416662) is 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid.
What is the SMILES notation for 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid?
The canonical SMILES for 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid is Cc1[nH]nc(CC(=O)O)c1C.
What is the InChIKey of 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid?
The InChIKey is LDOLRTRTEIZUSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4-5(2)8-9-6(4)3-7(10)11/h3H2,1-2H3,(H,8,9)(H,10,11).
What are the key properties of 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid?
2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid has a molecular weight of 154.17 g/mol, XLogP of 0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-1H-pyrazol-3-yl)acetic acid is sourced from PubChem (CID 82416662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).