About 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone
2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone (PubChem CID 82416690) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone |
| PubChem CID | 82416690 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone |
| SMILES | Cc1nc(C)c(C(=O)CN)o1 |
| InChI | InChI=1S/C7H10N2O2/c1-4-7(6(10)3-8)11-5(2)9-4/h3,8H2,1-2H3 |
| InChIKey | WLMXQIUAEFMJGC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone?
The IUPAC name of 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone (CID 82416690) is 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone.
What is the SMILES notation for 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone?
The canonical SMILES for 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone is Cc1nc(C)c(C(=O)CN)o1.
What is the InChIKey of 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone?
The InChIKey is WLMXQIUAEFMJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4-7(6(10)3-8)11-5(2)9-4/h3,8H2,1-2H3.
What are the key properties of 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone?
2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone has a molecular weight of 154.17 g/mol, XLogP of 0.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,4-dimethyl-1,3-oxazol-5-yl)ethanone is sourced from PubChem (CID 82416690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).