About imidazo[2,1-b][1,3]thiazol-5-ylmethanamine
imidazo[2,1-b][1,3]thiazol-5-ylmethanamine (PubChem CID 82416838) has the molecular formula C6H7N3S
and a molecular weight of 153.21 g/mol. Its IUPAC name is imidazo[2,1-b][1,3]thiazol-5-ylmethanamine.
Molecular Properties
| Compound Name | imidazo[2,1-b][1,3]thiazol-5-ylmethanamine |
| PubChem CID | 82416838 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | imidazo[2,1-b][1,3]thiazol-5-ylmethanamine |
| SMILES | NCc1cnc2sccn12 |
| InChI | InChI=1S/C6H7N3S/c7-3-5-4-8-6-9(5)1-2-10-6/h1-2,4H,3,7H2 |
| InChIKey | KKXVXXAFXMPTMT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[2,1-b][1,3]thiazol-5-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[2,1-b][1,3]thiazol-5-ylmethanamine?
The IUPAC name of imidazo[2,1-b][1,3]thiazol-5-ylmethanamine (CID 82416838) is imidazo[2,1-b][1,3]thiazol-5-ylmethanamine.
What is the SMILES notation for imidazo[2,1-b][1,3]thiazol-5-ylmethanamine?
The canonical SMILES for imidazo[2,1-b][1,3]thiazol-5-ylmethanamine is NCc1cnc2sccn12.
What is the InChIKey of imidazo[2,1-b][1,3]thiazol-5-ylmethanamine?
The InChIKey is KKXVXXAFXMPTMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3S/c7-3-5-4-8-6-9(5)1-2-10-6/h1-2,4H,3,7H2.
What are the key properties of imidazo[2,1-b][1,3]thiazol-5-ylmethanamine?
imidazo[2,1-b][1,3]thiazol-5-ylmethanamine has a molecular weight of 153.21 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[2,1-b][1,3]thiazol-5-ylmethanamine is sourced from PubChem (CID 82416838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).