About 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile
3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile (PubChem CID 82416843) has the molecular formula C6H7N3S
and a molecular weight of 153.21 g/mol. Its IUPAC name is 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile |
| PubChem CID | 82416843 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile |
| SMILES | CC(C)c1nsc(C#N)n1 |
| InChI | InChI=1S/C6H7N3S/c1-4(2)6-8-5(3-7)10-9-6/h4H,1-2H3 |
| InChIKey | FVUIMCWWQSUBQM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile?
The IUPAC name of 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile (CID 82416843) is 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile.
What is the SMILES notation for 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile?
The canonical SMILES for 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile is CC(C)c1nsc(C#N)n1.
What is the InChIKey of 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile?
The InChIKey is FVUIMCWWQSUBQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3S/c1-4(2)6-8-5(3-7)10-9-6/h4H,1-2H3.
What are the key properties of 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile?
3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile has a molecular weight of 153.21 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-1,2,4-thiadiazole-5-carbonitrile is sourced from PubChem (CID 82416843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).