C7H11N3O — CID 82416866
1-(1H-pyrazol-5-ylmethyl)azetidin-3-ol (PubChem CID 82416866) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-ylmethyl)azetidin-3-ol.
| Compound Name | 1-(1H-pyrazol-5-ylmethyl)azetidin-3-ol |
|---|---|
| PubChem CID | 82416866 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 1-(1H-pyrazol-5-ylmethyl)azetidin-3-ol |
| SMILES | OC1CN(Cc2ccn[nH]2)C1 |
| InChI | InChI=1S/C7H11N3O/c11-7-4-10(5-7)3-6-1-2-8-9-6/h1-2,7,11H,3-5H2,(H,8,9) |
| InChIKey | AMXMUOQPTBOXQW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |