About 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one
4-(5-methyl-1,2-oxazol-3-yl)butan-2-one (PubChem CID 82416948) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one.
Molecular Properties
| Compound Name | 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one |
| PubChem CID | 82416948 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one |
| SMILES | CC(=O)CCc1cc(C)on1 |
| InChI | InChI=1S/C8H11NO2/c1-6(10)3-4-8-5-7(2)11-9-8/h5H,3-4H2,1-2H3 |
| InChIKey | VKIIALIXURGIDV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one?
The IUPAC name of 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one (CID 82416948) is 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one.
What is the SMILES notation for 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one?
The canonical SMILES for 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one is CC(=O)CCc1cc(C)on1.
What is the InChIKey of 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one?
The InChIKey is VKIIALIXURGIDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-6(10)3-4-8-5-7(2)11-9-8/h5H,3-4H2,1-2H3.
What are the key properties of 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one?
4-(5-methyl-1,2-oxazol-3-yl)butan-2-one has a molecular weight of 153.18 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1,2-oxazol-3-yl)butan-2-one is sourced from PubChem (CID 82416948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).