About thieno[3,4-d][1,3]oxazole-2-carbaldehyde
thieno[3,4-d][1,3]oxazole-2-carbaldehyde (PubChem CID 82416977) has the molecular formula C6H3NO2S
and a molecular weight of 153.16 g/mol. Its IUPAC name is thieno[3,4-d][1,3]oxazole-2-carbaldehyde.
Molecular Properties
| Compound Name | thieno[3,4-d][1,3]oxazole-2-carbaldehyde |
| PubChem CID | 82416977 |
| Molecular Formula | C6H3NO2S |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 152.99 |
| IUPAC Name | thieno[3,4-d][1,3]oxazole-2-carbaldehyde |
| SMILES | O=Cc1nc2cscc2o1 |
| InChI | InChI=1S/C6H3NO2S/c8-1-6-7-4-2-10-3-5(4)9-6/h1-3H |
| InChIKey | RBGTUZLVGOSSFW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze thieno[3,4-d][1,3]oxazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,4-d][1,3]oxazole-2-carbaldehyde?
The IUPAC name of thieno[3,4-d][1,3]oxazole-2-carbaldehyde (CID 82416977) is thieno[3,4-d][1,3]oxazole-2-carbaldehyde.
What is the SMILES notation for thieno[3,4-d][1,3]oxazole-2-carbaldehyde?
The canonical SMILES for thieno[3,4-d][1,3]oxazole-2-carbaldehyde is O=Cc1nc2cscc2o1.
What is the InChIKey of thieno[3,4-d][1,3]oxazole-2-carbaldehyde?
The InChIKey is RBGTUZLVGOSSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3NO2S/c8-1-6-7-4-2-10-3-5(4)9-6/h1-3H.
What are the key properties of thieno[3,4-d][1,3]oxazole-2-carbaldehyde?
thieno[3,4-d][1,3]oxazole-2-carbaldehyde has a molecular weight of 153.16 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,4-d][1,3]oxazole-2-carbaldehyde is sourced from PubChem (CID 82416977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).