C6H3NO2S — CID 82416977
thieno[3,4-d][1,3]oxazole-2-carbaldehyde (PubChem CID 82416977) has the molecular formula C6H3NO2S and a molecular weight of 153.16 g/mol. Its IUPAC name is thieno[3,4-d][1,3]oxazole-2-carbaldehyde.
| Compound Name | thieno[3,4-d][1,3]oxazole-2-carbaldehyde |
|---|---|
| PubChem CID | 82416977 |
| Molecular Formula | C6H3NO2S |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 152.99 |
| IUPAC Name | thieno[3,4-d][1,3]oxazole-2-carbaldehyde |
| SMILES | O=Cc1nc2cscc2o1 |
| InChI | InChI=1S/C6H3NO2S/c8-1-6-7-4-2-10-3-5(4)9-6/h1-3H |
| InChIKey | RBGTUZLVGOSSFW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|