About 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one
6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 82417010) has the molecular formula C7H7NO3
and a molecular weight of 153.14 g/mol. Its IUPAC name is 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one.
Molecular Properties
| Compound Name | 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| PubChem CID | 82417010 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | O=C1CC(O)Cc2oncc21 |
| InChI | InChI=1S/C7H7NO3/c9-4-1-6(10)5-3-8-11-7(5)2-4/h3-4,9H,1-2H2 |
| InChIKey | RLVHVEWDBDVBNG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one?
The IUPAC name of 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one (CID 82417010) is 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one.
What is the SMILES notation for 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one?
The canonical SMILES for 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one is O=C1CC(O)Cc2oncc21.
What is the InChIKey of 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one?
The InChIKey is RLVHVEWDBDVBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c9-4-1-6(10)5-3-8-11-7(5)2-4/h3-4,9H,1-2H2.
What are the key properties of 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one?
6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one has a molecular weight of 153.14 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-6,7-dihydro-5H-1,2-benzoxazol-4-one is sourced from PubChem (CID 82417010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).