About 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine
2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine (PubChem CID 82417238) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine.
Analyze 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine?
The IUPAC name of 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine (CID 82417238) is 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine.
What is the SMILES notation for 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine?
The canonical SMILES for 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine is Cc1c2c(nn1C)CNCC2.
What is the InChIKey of 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine?
The InChIKey is XQLGXRKJUDWXEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6-7-3-4-9-5-8(7)10-11(6)2/h9H,3-5H2,1-2H3.
What are the key properties of 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine?
2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine has a molecular weight of 151.21 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine is sourced from PubChem (CID 82417238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).