C8H13N3 — CID 82417292
3-methyl-4,5,6,7-tetrahydro-2H-indazol-6-amine (PubChem CID 82417292) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-methyl-4,5,6,7-tetrahydro-2H-indazol-6-amine.
| Compound Name | 3-methyl-4,5,6,7-tetrahydro-2H-indazol-6-amine |
|---|---|
| PubChem CID | 82417292 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 3-methyl-4,5,6,7-tetrahydro-2H-indazol-6-amine |
| SMILES | Cc1[nH]nc2c1CCC(N)C2 |
| InChI | InChI=1S/C8H13N3/c1-5-7-3-2-6(9)4-8(7)11-10-5/h6H,2-4,9H2,1H3,(H,10,11) |
| InChIKey | OOOAYVNFVFIESQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |