About 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone
1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone (PubChem CID 82417563) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone.
Analyze 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone?
The IUPAC name of 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone (CID 82417563) is 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone.
What is the SMILES notation for 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone?
The canonical SMILES for 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone is CC(=O)c1cc2c([nH]1)CCC2.
What is the InChIKey of 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone?
The InChIKey is KCZISQWCRMIYTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-6(11)9-5-7-3-2-4-8(7)10-9/h5,10H,2-4H2,1H3.
What are the key properties of 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone?
1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone has a molecular weight of 149.19 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4,5,6-tetrahydrocyclopenta[b]pyrrol-2-yl)ethanone is sourced from PubChem (CID 82417563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).