About 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde
2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde (PubChem CID 82417707) has the molecular formula C7H5N3O
and a molecular weight of 147.14 g/mol. Its IUPAC name is 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde |
| PubChem CID | 82417707 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1[nH]nc2cccnc12 |
| InChI | InChI=1S/C7H5N3O/c11-4-6-7-5(9-10-6)2-1-3-8-7/h1-4H,(H,9,10) |
| InChIKey | QXYPRHHNIMYYRY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde?
The IUPAC name of 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde (CID 82417707) is 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde.
What is the SMILES notation for 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde?
The canonical SMILES for 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde is O=Cc1[nH]nc2cccnc12.
What is the InChIKey of 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde?
The InChIKey is QXYPRHHNIMYYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O/c11-4-6-7-5(9-10-6)2-1-3-8-7/h1-4H,(H,9,10).
What are the key properties of 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde?
2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde has a molecular weight of 147.14 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrazolo[4,3-b]pyridine-3-carbaldehyde is sourced from PubChem (CID 82417707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).