About 2-methyl-2,5-diazaspiro[3.5]nonane
2-methyl-2,5-diazaspiro[3.5]nonane (PubChem CID 82418156) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-methyl-2,5-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 2-methyl-2,5-diazaspiro[3.5]nonane |
| PubChem CID | 82418156 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2-methyl-2,5-diazaspiro[3.5]nonane |
| SMILES | CN1CC2(CCCCN2)C1 |
| InChI | InChI=1S/C8H16N2/c1-10-6-8(7-10)4-2-3-5-9-8/h9H,2-7H2,1H3 |
| InChIKey | QSNDDQRDKONJEQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,5-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,5-diazaspiro[3.5]nonane?
The IUPAC name of 2-methyl-2,5-diazaspiro[3.5]nonane (CID 82418156) is 2-methyl-2,5-diazaspiro[3.5]nonane.
What is the SMILES notation for 2-methyl-2,5-diazaspiro[3.5]nonane?
The canonical SMILES for 2-methyl-2,5-diazaspiro[3.5]nonane is CN1CC2(CCCCN2)C1.
What is the InChIKey of 2-methyl-2,5-diazaspiro[3.5]nonane?
The InChIKey is QSNDDQRDKONJEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-10-6-8(7-10)4-2-3-5-9-8/h9H,2-7H2,1H3.
What are the key properties of 2-methyl-2,5-diazaspiro[3.5]nonane?
2-methyl-2,5-diazaspiro[3.5]nonane has a molecular weight of 140.23 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,5-diazaspiro[3.5]nonane is sourced from PubChem (CID 82418156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).