About 5-methylfuro[2,3-d][1,2]oxazol-3-amine
5-methylfuro[2,3-d][1,2]oxazol-3-amine (PubChem CID 82418489) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 5-methylfuro[2,3-d][1,2]oxazol-3-amine.
Molecular Properties
| Compound Name | 5-methylfuro[2,3-d][1,2]oxazol-3-amine |
| PubChem CID | 82418489 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 5-methylfuro[2,3-d][1,2]oxazol-3-amine |
| SMILES | Cc1cc2onc(N)c2o1 |
| InChI | InChI=1S/C6H6N2O2/c1-3-2-4-5(9-3)6(7)8-10-4/h2H,1H3,(H2,7,8) |
| InChIKey | IKFGAWOAICVLTB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylfuro[2,3-d][1,2]oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylfuro[2,3-d][1,2]oxazol-3-amine?
The IUPAC name of 5-methylfuro[2,3-d][1,2]oxazol-3-amine (CID 82418489) is 5-methylfuro[2,3-d][1,2]oxazol-3-amine.
What is the SMILES notation for 5-methylfuro[2,3-d][1,2]oxazol-3-amine?
The canonical SMILES for 5-methylfuro[2,3-d][1,2]oxazol-3-amine is Cc1cc2onc(N)c2o1.
What is the InChIKey of 5-methylfuro[2,3-d][1,2]oxazol-3-amine?
The InChIKey is IKFGAWOAICVLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c1-3-2-4-5(9-3)6(7)8-10-4/h2H,1H3,(H2,7,8).
What are the key properties of 5-methylfuro[2,3-d][1,2]oxazol-3-amine?
5-methylfuro[2,3-d][1,2]oxazol-3-amine has a molecular weight of 138.13 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylfuro[2,3-d][1,2]oxazol-3-amine is sourced from PubChem (CID 82418489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).