5-cyano-1,2-oxazole-3-carboxylic acid

C5H2N2O3 — CID 82418504

IUPAC5-cyano-1,2-oxazole-3-carboxylic acid
SMILESN#Cc1cc(C(=O)O)no1
InChIInChI=1S/C5H2N2O3/c6-2-3-1-4(5(8)9)7-10-3/h1H,(H,8,9)
InChIKeyUHAULYQZAGMLBN-UHFFFAOYSA-N
MW138.08 g/mol
LogP0.24
Rot. Bonds1

About 5-cyano-1,2-oxazole-3-carboxylic acid

5-cyano-1,2-oxazole-3-carboxylic acid (PubChem CID 82418504) has the molecular formula C5H2N2O3 and a molecular weight of 138.08 g/mol. Its IUPAC name is 5-cyano-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-cyano-1,2-oxazole-3-carboxylic acid
PubChem CID82418504
Molecular FormulaC5H2N2O3
Molecular Weight138.08 g/mol
Exact Mass138.01
IUPAC Name5-cyano-1,2-oxazole-3-carboxylic acid
SMILESN#Cc1cc(C(=O)O)no1
InChIInChI=1S/C5H2N2O3/c6-2-3-1-4(5(8)9)7-10-3/h1H,(H,8,9)
InChIKeyUHAULYQZAGMLBN-UHFFFAOYSA-N
XLogP0.24
TPSA87.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500138.08
LogP ≤ 50.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-cyano-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-cyano-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-cyano-1,2-oxazole-3-carboxylic acid (CID 82418504) is 5-cyano-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-cyano-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-cyano-1,2-oxazole-3-carboxylic acid is N#Cc1cc(C(=O)O)no1.
What is the InChIKey of 5-cyano-1,2-oxazole-3-carboxylic acid?
The InChIKey is UHAULYQZAGMLBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2N2O3/c6-2-3-1-4(5(8)9)7-10-3/h1H,(H,8,9).
What are the key properties of 5-cyano-1,2-oxazole-3-carboxylic acid?
5-cyano-1,2-oxazole-3-carboxylic acid has a molecular weight of 138.08 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 82418504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).