About [1,2,4]triazolo[4,3-a]pyridin-6-ol
[1,2,4]triazolo[4,3-a]pyridin-6-ol (PubChem CID 82418659) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-a]pyridin-6-ol.
Molecular Properties
| Compound Name | [1,2,4]triazolo[4,3-a]pyridin-6-ol |
| PubChem CID | 82418659 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | [1,2,4]triazolo[4,3-a]pyridin-6-ol |
| SMILES | Oc1ccc2nncn2c1 |
| InChI | InChI=1S/C6H5N3O/c10-5-1-2-6-8-7-4-9(6)3-5/h1-4,10H |
| InChIKey | PASKHTGTPULKCZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,2,4]triazolo[4,3-a]pyridin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,4]triazolo[4,3-a]pyridin-6-ol?
The IUPAC name of [1,2,4]triazolo[4,3-a]pyridin-6-ol (CID 82418659) is [1,2,4]triazolo[4,3-a]pyridin-6-ol.
What is the SMILES notation for [1,2,4]triazolo[4,3-a]pyridin-6-ol?
The canonical SMILES for [1,2,4]triazolo[4,3-a]pyridin-6-ol is Oc1ccc2nncn2c1.
What is the InChIKey of [1,2,4]triazolo[4,3-a]pyridin-6-ol?
The InChIKey is PASKHTGTPULKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c10-5-1-2-6-8-7-4-9(6)3-5/h1-4,10H.
What are the key properties of [1,2,4]triazolo[4,3-a]pyridin-6-ol?
[1,2,4]triazolo[4,3-a]pyridin-6-ol has a molecular weight of 135.13 g/mol, XLogP of 0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]triazolo[4,3-a]pyridin-6-ol is sourced from PubChem (CID 82418659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).