About 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole
3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole (PubChem CID 82418896) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole.
Molecular Properties
| Compound Name | 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole |
| PubChem CID | 82418896 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole |
| SMILES | Cc1noc2c1CNC2 |
| InChI | InChI=1S/C6H8N2O/c1-4-5-2-7-3-6(5)9-8-4/h7H,2-3H2,1H3 |
| InChIKey | PFRUBLHLWUJTOL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole?
The IUPAC name of 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole (CID 82418896) is 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole.
What is the SMILES notation for 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole?
The canonical SMILES for 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole is Cc1noc2c1CNC2.
What is the InChIKey of 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole?
The InChIKey is PFRUBLHLWUJTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c1-4-5-2-7-3-6(5)9-8-4/h7H,2-3H2,1H3.
What are the key properties of 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole?
3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole has a molecular weight of 124.14 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,2]oxazole is sourced from PubChem (CID 82418896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).