C16H17ClN2O2 — CID 82419252
3-[1-(2,4-dimethylphenyl)-6-methyl-4-oxopyridazin-3-yl]propanoyl chloride (PubChem CID 82419252) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 3-[1-(2,4-dimethylphenyl)-6-methyl-4-oxopyridazin-3-yl]propanoyl chloride.
| Compound Name | 3-[1-(2,4-dimethylphenyl)-6-methyl-4-oxopyridazin-3-yl]propanoyl chloride |
|---|---|
| PubChem CID | 82419252 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-[1-(2,4-dimethylphenyl)-6-methyl-4-oxopyridazin-3-yl]propanoyl chloride |
| SMILES | Cc1ccc(-n2nc(CCC(=O)Cl)c(=O)cc2C)c(C)c1 |
| InChI | InChI=1S/C16H17ClN2O2/c1-10-4-6-14(11(2)8-10)19-12(3)9-15(20)13(18-19)5-7-16(17)21/h4,6,8-9H,5,7H2,1-3H3 |
| InChIKey | GVLOJZSOWFPDFA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|