C12H9F3N2O2S — CID 82421448
5-hydroxy-6-(sulfanylmethyl)-2-[4-(trifluoromethyl)phenyl]pyridazin-3-one (PubChem CID 82421448) has the molecular formula C12H9F3N2O2S and a molecular weight of 302.28 g/mol. Its IUPAC name is 5-hydroxy-6-(sulfanylmethyl)-2-[4-(trifluoromethyl)phenyl]pyridazin-3-one.
| Compound Name | 5-hydroxy-6-(sulfanylmethyl)-2-[4-(trifluoromethyl)phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 82421448 |
| Molecular Formula | C12H9F3N2O2S |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 5-hydroxy-6-(sulfanylmethyl)-2-[4-(trifluoromethyl)phenyl]pyridazin-3-one |
| SMILES | O=c1cc(O)c(CS)nn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F3N2O2S/c13-12(14,15)7-1-3-8(4-2-7)17-11(19)5-10(18)9(6-20)16-17/h1-5,18,20H,6H2 |
| InChIKey | YKUORSJDZFYMJS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|