C12H12ClNOS2 — CID 82423099
[2-[(4-chloro-2-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol (PubChem CID 82423099) has the molecular formula C12H12ClNOS2 and a molecular weight of 285.82 g/mol. Its IUPAC name is [2-[(4-chloro-2-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [2-[(4-chloro-2-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82423099 |
| Molecular Formula | C12H12ClNOS2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | [2-[(4-chloro-2-methylphenoxy)methyl]-1,3-thiazol-5-yl]methanethiol |
| SMILES | Cc1cc(Cl)ccc1OCc1ncc(CS)s1 |
| InChI | InChI=1S/C12H12ClNOS2/c1-8-4-9(13)2-3-11(8)15-6-12-14-5-10(7-16)17-12/h2-5,16H,6-7H2,1H3 |
| InChIKey | FOMNFDSDNLSTAI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|