C10H14N4S3 — CID 82423261
3-[2-(methylsulfanylmethyl)-1,3-thiazol-5-yl]-4-propan-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 82423261) has the molecular formula C10H14N4S3 and a molecular weight of 286.45 g/mol. Its IUPAC name is 3-[2-(methylsulfanylmethyl)-1,3-thiazol-5-yl]-4-propan-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2-(methylsulfanylmethyl)-1,3-thiazol-5-yl]-4-propan-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82423261 |
| Molecular Formula | C10H14N4S3 |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 3-[2-(methylsulfanylmethyl)-1,3-thiazol-5-yl]-4-propan-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CSCc1ncc(-c2n[nH]c(=S)n2C(C)C)s1 |
| InChI | InChI=1S/C10H14N4S3/c1-6(2)14-9(12-13-10(14)15)7-4-11-8(17-7)5-16-3/h4,6H,5H2,1-3H3,(H,13,15) |
| InChIKey | VNPAVOFOFYZIHJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|