C9H11N3O3S3 — CID 82423462
5-[2-(propan-2-ylsulfonylmethyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82423462) has the molecular formula C9H11N3O3S3 and a molecular weight of 305.41 g/mol. Its IUPAC name is 5-[2-(propan-2-ylsulfonylmethyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(propan-2-ylsulfonylmethyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82423462 |
| Molecular Formula | C9H11N3O3S3 |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 5-[2-(propan-2-ylsulfonylmethyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CC(C)S(=O)(=O)Cc1ncc(-c2n[nH]c(=S)o2)s1 |
| InChI | InChI=1S/C9H11N3O3S3/c1-5(2)18(13,14)4-7-10-3-6(17-7)8-11-12-9(16)15-8/h3,5H,4H2,1-2H3,(H,12,16) |
| InChIKey | BPECZXZOHQIHII-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|