C15H19NO2S — CID 82423770
2-[2-[2-(2-methylphenoxy)ethyl]-1,3-thiazol-5-yl]propan-2-ol (PubChem CID 82423770) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[2-[2-(2-methylphenoxy)ethyl]-1,3-thiazol-5-yl]propan-2-ol.
| Compound Name | 2-[2-[2-(2-methylphenoxy)ethyl]-1,3-thiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 82423770 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[2-[2-(2-methylphenoxy)ethyl]-1,3-thiazol-5-yl]propan-2-ol |
| SMILES | Cc1ccccc1OCCc1ncc(C(C)(C)O)s1 |
| InChI | InChI=1S/C15H19NO2S/c1-11-6-4-5-7-12(11)18-9-8-14-16-10-13(19-14)15(2,3)17/h4-7,10,17H,8-9H2,1-3H3 |
| InChIKey | UHOFYLSDYYNRHI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |