C11H14N2O3S — CID 82424816
(E)-3-[2-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 82424816) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is (E)-3-[2-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82424816 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (E)-3-[2-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(CN2CCOCC2)s1 |
| InChI | InChI=1S/C11H14N2O3S/c14-11(15)2-1-9-7-12-10(17-9)8-13-3-5-16-6-4-13/h1-2,7H,3-6,8H2,(H,14,15)/b2-1+ |
| InChIKey | MNPMIANTFQHLGQ-OWOJBTEDSA-N |
| XLogP | 1.07 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|