C11H15N5OS2 — CID 82424846
5-[2-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82424846) has the molecular formula C11H15N5OS2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 5-[2-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82424846 |
| Molecular Formula | C11H15N5OS2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-[2-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CN1CCN(Cc2ncc(-c3n[nH]c(=S)o3)s2)CC1 |
| InChI | InChI=1S/C11H15N5OS2/c1-15-2-4-16(5-3-15)7-9-12-6-8(19-9)10-13-14-11(18)17-10/h6H,2-5,7H2,1H3,(H,14,18) |
| InChIKey | HWJCBLDNTUMMOA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|