C9H12N4OS2 — CID 82424908
5-[2-[2-(dimethylamino)ethyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82424908) has the molecular formula C9H12N4OS2 and a molecular weight of 256.36 g/mol. Its IUPAC name is 5-[2-[2-(dimethylamino)ethyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-[2-(dimethylamino)ethyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82424908 |
| Molecular Formula | C9H12N4OS2 |
| Molecular Weight | 256.36 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-[2-[2-(dimethylamino)ethyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CN(C)CCc1ncc(-c2n[nH]c(=S)o2)s1 |
| InChI | InChI=1S/C9H12N4OS2/c1-13(2)4-3-7-10-5-6(16-7)8-11-12-9(15)14-8/h5H,3-4H2,1-2H3,(H,12,15) |
| InChIKey | MEGTWPAGVNGQAO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|