C13H18N4OS2 — CID 82425034
5-[2-[2-(4-methylpiperidin-1-yl)ethyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82425034) has the molecular formula C13H18N4OS2 and a molecular weight of 310.45 g/mol. Its IUPAC name is 5-[2-[2-(4-methylpiperidin-1-yl)ethyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-[2-(4-methylpiperidin-1-yl)ethyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82425034 |
| Molecular Formula | C13H18N4OS2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 5-[2-[2-(4-methylpiperidin-1-yl)ethyl]-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CC1CCN(CCc2ncc(-c3n[nH]c(=S)o3)s2)CC1 |
| InChI | InChI=1S/C13H18N4OS2/c1-9-2-5-17(6-3-9)7-4-11-14-8-10(20-11)12-15-16-13(19)18-12/h8-9H,2-7H2,1H3,(H,16,19) |
| InChIKey | CZFMDHVXHSHUJH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|