C11H19N3S2 — CID 82425050
[2-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-5-yl]methanethiol (PubChem CID 82425050) has the molecular formula C11H19N3S2 and a molecular weight of 257.43 g/mol. Its IUPAC name is [2-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-5-yl]methanethiol.
| Compound Name | [2-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-5-yl]methanethiol |
|---|---|
| PubChem CID | 82425050 |
| Molecular Formula | C11H19N3S2 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | [2-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-5-yl]methanethiol |
| SMILES | CN1CCN(CCc2ncc(CS)s2)CC1 |
| InChI | InChI=1S/C11H19N3S2/c1-13-4-6-14(7-5-13)3-2-11-12-8-10(9-15)16-11/h8,15H,2-7,9H2,1H3 |
| InChIKey | OFOQGZOWZGYSCP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 19.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|