About 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide
2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide (PubChem CID 82425132) has the molecular formula C11H18N4S
and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide.
Molecular Properties
| Compound Name | 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide |
| PubChem CID | 82425132 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(CN2CCCCCC2)s1 |
| InChI | InChI=1S/C11H18N4S/c12-11(13)9-7-14-10(16-9)8-15-5-3-1-2-4-6-15/h7H,1-6,8H2,(H3,12,13) |
| InChIKey | CNPOSSRCROBIIO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide?
The IUPAC name of 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide (CID 82425132) is 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide.
What is the SMILES notation for 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide?
The canonical SMILES for 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide is [H]/N=C(\N)c1cnc(CN2CCCCCC2)s1.
What is the InChIKey of 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide?
The InChIKey is CNPOSSRCROBIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4S/c12-11(13)9-7-14-10(16-9)8-15-5-3-1-2-4-6-15/h7H,1-6,8H2,(H3,12,13).
What are the key properties of 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide?
2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide has a molecular weight of 238.36 g/mol, XLogP of 1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-ylmethyl)-1,3-thiazole-5-carboximidamide is sourced from PubChem (CID 82425132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).