About 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol
2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol (PubChem CID 82425197) has the molecular formula C10H18N2OS
and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol |
| PubChem CID | 82425197 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol |
| SMILES | CCN(CC)c1ncc(C(C)(C)O)s1 |
| InChI | InChI=1S/C10H18N2OS/c1-5-12(6-2)9-11-7-8(14-9)10(3,4)13/h7,13H,5-6H2,1-4H3 |
| InChIKey | JSKUGVSUBLSYMU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol?
The IUPAC name of 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol (CID 82425197) is 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol.
What is the SMILES notation for 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol?
The canonical SMILES for 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol is CCN(CC)c1ncc(C(C)(C)O)s1.
What is the InChIKey of 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol?
The InChIKey is JSKUGVSUBLSYMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2OS/c1-5-12(6-2)9-11-7-8(14-9)10(3,4)13/h7,13H,5-6H2,1-4H3.
What are the key properties of 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol?
2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol has a molecular weight of 214.33 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diethylamino)-1,3-thiazol-5-yl]propan-2-ol is sourced from PubChem (CID 82425197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).