C13H14N2OS2 — CID 82425986
4-methyl-2-[(3-methylphenoxy)methyl]-1,3-thiazole-5-carbothioamide (PubChem CID 82425986) has the molecular formula C13H14N2OS2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-methyl-2-[(3-methylphenoxy)methyl]-1,3-thiazole-5-carbothioamide.
| Compound Name | 4-methyl-2-[(3-methylphenoxy)methyl]-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82425986 |
| Molecular Formula | C13H14N2OS2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 4-methyl-2-[(3-methylphenoxy)methyl]-1,3-thiazole-5-carbothioamide |
| SMILES | Cc1cccc(OCc2nc(C)c(C(N)=S)s2)c1 |
| InChI | InChI=1S/C13H14N2OS2/c1-8-4-3-5-10(6-8)16-7-11-15-9(2)12(18-11)13(14)17/h3-6H,7H2,1-2H3,(H2,14,17) |
| InChIKey | NBXSISMDIQCDQE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|