C12H22N2O3S2 — CID 82426453
2-methoxy-N-[[4-methyl-2-(propan-2-ylsulfonylmethyl)-1,3-thiazol-5-yl]methyl]ethanamine (PubChem CID 82426453) has the molecular formula C12H22N2O3S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-methoxy-N-[[4-methyl-2-(propan-2-ylsulfonylmethyl)-1,3-thiazol-5-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[4-methyl-2-(propan-2-ylsulfonylmethyl)-1,3-thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 82426453 |
| Molecular Formula | C12H22N2O3S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-methoxy-N-[[4-methyl-2-(propan-2-ylsulfonylmethyl)-1,3-thiazol-5-yl]methyl]ethanamine |
| SMILES | COCCNCc1sc(CS(=O)(=O)C(C)C)nc1C |
| InChI | InChI=1S/C12H22N2O3S2/c1-9(2)19(15,16)8-12-14-10(3)11(18-12)7-13-5-6-17-4/h9,13H,5-8H2,1-4H3 |
| InChIKey | GDSAIMVAFRFBHG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|