C10H17N3S2 — CID 82427411
2-(diethylaminomethyl)-4-methyl-1,3-thiazole-5-carbothioamide (PubChem CID 82427411) has the molecular formula C10H17N3S2 and a molecular weight of 243.40 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-4-methyl-1,3-thiazole-5-carbothioamide.
| Compound Name | 2-(diethylaminomethyl)-4-methyl-1,3-thiazole-5-carbothioamide |
|---|---|
| PubChem CID | 82427411 |
| Molecular Formula | C10H17N3S2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(diethylaminomethyl)-4-methyl-1,3-thiazole-5-carbothioamide |
| SMILES | CCN(CC)Cc1nc(C)c(C(N)=S)s1 |
| InChI | InChI=1S/C10H17N3S2/c1-4-13(5-2)6-8-12-7(3)9(15-8)10(11)14/h4-6H2,1-3H3,(H2,11,14) |
| InChIKey | VIIDRQLXYDLCAD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|