C9H13BrN2S — CID 82427860
5-(bromomethyl)-4-methyl-2-pyrrolidin-1-yl-1,3-thiazole (PubChem CID 82427860) has the molecular formula C9H13BrN2S and a molecular weight of 261.19 g/mol. Its IUPAC name is 5-(bromomethyl)-4-methyl-2-pyrrolidin-1-yl-1,3-thiazole.
| Compound Name | 5-(bromomethyl)-4-methyl-2-pyrrolidin-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 82427860 |
| Molecular Formula | C9H13BrN2S |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 5-(bromomethyl)-4-methyl-2-pyrrolidin-1-yl-1,3-thiazole |
| SMILES | Cc1nc(N2CCCC2)sc1CBr |
| InChI | InChI=1S/C9H13BrN2S/c1-7-8(6-10)13-9(11-7)12-4-2-3-5-12/h2-6H2,1H3 |
| InChIKey | YOZRKIDMUIWCKZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|